CAS 2379322-84-4 is the registry number for tert-Butyl 4-(benzyloxy)-3-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
Tert-butyl 3-chloro-4-phenylmethoxybenzoate (CAS 2379322-84-4) is a chemical compound with the molecular formula C18H19ClO3 and a molecular weight of 318.8 g/mol. IUPAC name: tert-butyl 3-chloro-4-phenylmethoxybenzoate. InChIKey: IYPMBEDLQGIBSY-UHFFFAOYSA-N.
| Molecular formula | C18H19ClO3 |
|---|---|
| Molecular weight | 318.8 g/mol |
| IUPAC name | tert-butyl 3-chloro-4-phenylmethoxybenzoate |
| InChIKey | IYPMBEDLQGIBSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)