Products 2379390-80-2
CAS 2379390-80-2 is the registry number for RBN010860. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(5-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one (CAS 2379390-80-2) is a chemical compound with the molecular formula C18H19F3N4O2 and a molecular weight of 380.4 g/mol. IUPAC name: 4-(5-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one. InChIKey: NTKDEOOSCFGSNC-UHFFFAOYSA-N.
| Molecular formula | C18H19F3N4O2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 4-(5-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one |
| InChIKey | NTKDEOOSCFGSNC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC3=C(CN(C3)C4=C(C(=O)NN=C4)C(F)(F)F)C=C2 |
Computed by PubChem (NCBI)