CAS 23795-03-1 is the registry number for Probenecid (sodium), 99.37%. Offered by: MedChemExpress. Available pack sizes: 500 mg, 100 g, 10mM/1mL, 50 g, 25 g, 1 g, 5 g, 10 g.
Sodium 4-(dipropylsulfamoyl)benzoate (CAS 23795-03-1) is a chemical compound with the molecular formula C13H18NNaO4S and a molecular weight of 307.34 g/mol. IUPAC name: sodium 4-(dipropylsulfamoyl)benzoate. InChIKey: QCCCFHDTBTUDEA-UHFFFAOYSA-M.
| Molecular formula | C13H18NNaO4S |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | sodium 4-(dipropylsulfamoyl)benzoate |
| InChIKey | QCCCFHDTBTUDEA-UHFFFAOYSA-M |
| SMILES | CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)