CAS 2379878-05-2 is the registry number for Picosulfate Impurity 1 Disodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Disodium;[4-[hydroxy-pyridin-2-yl-(4-sulfonatooxyphenyl)methyl]phenyl] sulfate (CAS 2379878-05-2) is a chemical compound with the molecular formula C18H13NNa2O9S2 and a molecular weight of 497.4 g/mol. IUPAC name: disodium;[4-[hydroxy-pyridin-2-yl-(4-sulfonatooxyphenyl)methyl]phenyl] sulfate. InChIKey: LXCYQYKPRNHANI-UHFFFAOYSA-L.
| Molecular formula | C18H13NNa2O9S2 |
|---|---|
| Molecular weight | 497.4 g/mol |
| IUPAC name | disodium;[4-[hydroxy-pyridin-2-yl-(4-sulfonatooxyphenyl)methyl]phenyl] sulfate |
| InChIKey | LXCYQYKPRNHANI-UHFFFAOYSA-L |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)OS(=O)(=O)[O-])(C3=CC=C(C=C3)OS(=O)(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)