CAS 2379890-92-1 is the registry number for Anti-MRSA agent 24. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,8-difluoro-3-(2-methylpropanoyl)-2-(2,3,4-trifluoroanilino)-1H-quinolin-4-one (CAS 2379890-92-1) is a chemical compound with the molecular formula C19H13F5N2O2 and a molecular weight of 396.3 g/mol. IUPAC name: 6,8-difluoro-3-(2-methylpropanoyl)-2-(2,3,4-trifluoroanilino)-1H-quinolin-4-one. InChIKey: DMIXYWAIQQRKNT-UHFFFAOYSA-N.
| Molecular formula | C19H13F5N2O2 |
|---|---|
| Molecular weight | 396.3 g/mol |
| IUPAC name | 6,8-difluoro-3-(2-methylpropanoyl)-2-(2,3,4-trifluoroanilino)-1H-quinolin-4-one |
| InChIKey | DMIXYWAIQQRKNT-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C(NC2=C(C1=O)C=C(C=C2F)F)NC3=C(C(=C(C=C3)F)F)F |
Computed by PubChem (NCBI)