Products 2380033-51-0
CAS 2380033-51-0 is the registry number for GPR183 inverse agonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[1-(4-bromobenzoyl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one (CAS 2380033-51-0) is a chemical compound with the molecular formula C20H20BrN5O2 and a molecular weight of 442.3 g/mol. IUPAC name: 2-[[1-(4-bromobenzoyl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one. InChIKey: IDTBYVCLFRYLOS-UHFFFAOYSA-N.
| Molecular formula | C20H20BrN5O2 |
|---|---|
| Molecular weight | 442.3 g/mol |
| IUPAC name | 2-[[1-(4-bromobenzoyl)piperidin-4-yl]methyl]-6-pyrazol-1-ylpyridazin-3-one |
| InChIKey | IDTBYVCLFRYLOS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CN2C(=O)C=CC(=N2)N3C=CC=N3)C(=O)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)