CAS 2380036-45-1 is the registry number for 4'-((3,5-Dicarboxyphenyl)carbamoyl)-[1,1'-biphenyl]-3,5-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-[(3,5-dicarboxyphenyl)carbamoyl]phenyl]benzene-1,3-dicarboxylic acid (CAS 2380036-45-1) is a chemical compound with the molecular formula C23H15NO9 and a molecular weight of 449.4 g/mol. IUPAC name: 5-[4-[(3,5-dicarboxyphenyl)carbamoyl]phenyl]benzene-1,3-dicarboxylic acid. InChIKey: KVOBPYDDGODRNT-UHFFFAOYSA-N.
| Molecular formula | C23H15NO9 |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | 5-[4-[(3,5-dicarboxyphenyl)carbamoyl]phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | KVOBPYDDGODRNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)NC3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)