CAS 2380570-84-1 is the registry number for (3S,5R)-3-Amino-5-methylpyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5R)-3-amino-5-methylpyrrolidin-2-one (CAS 2380570-84-1) is a chemical compound with the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. IUPAC name: (3S,5R)-3-amino-5-methylpyrrolidin-2-one. InChIKey: SWTNSRXCWULTDK-DMTCNVIQSA-N.
| Molecular formula | C5H10N2O |
|---|---|
| Molecular weight | 114.15 g/mol |
| IUPAC name | (3S,5R)-3-amino-5-methylpyrrolidin-2-one |
| InChIKey | SWTNSRXCWULTDK-DMTCNVIQSA-N |
| SMILES | C[C@@H]1C[C@@H](C(=O)N1)N |
Computed by PubChem (NCBI)