Products 2380700-45-6

CAS 2380700-45-6 is the registry number for (R)-3-(Tetrahydrofuran-3-yl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(3R)-oxolan-3-yl]prop-2-ynoic acid (CAS 2380700-45-6) is a chemical compound with the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. IUPAC name: 3-[(3R)-oxolan-3-yl]prop-2-ynoic acid. InChIKey: UGQFNGGKPGZPBZ-LURJTMIESA-N.

Identity
Molecular formulaC7H8O3
Molecular weight140.14 g/mol
IUPAC name3-[(3R)-oxolan-3-yl]prop-2-ynoic acid
InChIKeyUGQFNGGKPGZPBZ-LURJTMIESA-N
SMILESC1COC[C@H]1C#CC(=O)O

Computed by PubChem (NCBI)