CAS 2380852-90-2 is the registry number for Benzyl (R)-4-amino-3,3-dimethylpyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (4R)-4-amino-3,3-dimethylpyrrolidine-1-carboxylate (CAS 2380852-90-2) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (4R)-4-amino-3,3-dimethylpyrrolidine-1-carboxylate. InChIKey: OMWSSIGSQHJXRQ-LBPRGKRZSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (4R)-4-amino-3,3-dimethylpyrrolidine-1-carboxylate |
| InChIKey | OMWSSIGSQHJXRQ-LBPRGKRZSA-N |
| SMILES | CC1(CN(C[C@@H]1N)C(=O)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)