Products 2380862-40-6
CAS 2380862-40-6 is the registry number for (1R,5R,6R)-3-azabicyclo[3.2.1]octan-6-ol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,5R,6R)-3-azabicyclo[3.2.1]octan-6-ol (CAS 2380862-40-6) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: (1R,5R,6R)-3-azabicyclo[3.2.1]octan-6-ol. InChIKey: HEZQDMDQUVBDOA-FSDSQADBSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | (1R,5R,6R)-3-azabicyclo[3.2.1]octan-6-ol |
| InChIKey | HEZQDMDQUVBDOA-FSDSQADBSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]1CNC2)O |
Computed by PubChem (NCBI)