CAS 238089-02-6 appears in our catalog under these names: Ospemifene E-Isomer, E-Ospemifene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2,5mg, 50mg.
2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol (CAS 238089-02-6) is a chemical compound with the molecular formula C24H23ClO2 and a molecular weight of 378.9 g/mol. IUPAC name: 2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol. InChIKey: LUMKNAVTFCDUIE-WCWDXBQESA-N.
| Molecular formula | C24H23ClO2 |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | 2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethanol |
| InChIKey | LUMKNAVTFCDUIE-WCWDXBQESA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/C3=CC=C(C=C3)OCCO)/CCCl |
Computed by PubChem (NCBI)