Products 2381-23-9

CAS 2381-23-9 appears in our catalog under these names: 9,10–DIOXO–9,10–DIHYDROANTHRACENE–2–SULFONYL CHLORIDE, 9,10-Dioxo-9,10-dihydroanthracene-2-sulfonyl chloride, 9,10-Dioxo-9,10-dihydroanthracene-2-sulfonyl chloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g.

Structural formula: {0} (CAS {1})

9,10-dioxoanthracene-2-sulfonyl chloride (CAS 2381-23-9) is a chemical compound with the molecular formula C14H7ClO4S and a molecular weight of 306.7 g/mol. IUPAC name: 9,10-dioxoanthracene-2-sulfonyl chloride. InChIKey: UDFCHANCMRCOQT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H7ClO4S
Molecular weight306.7 g/mol
IUPAC name9,10-dioxoanthracene-2-sulfonyl chloride
InChIKeyUDFCHANCMRCOQT-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)