CAS 2381196-81-0 appears in our catalog under these names: Boc–C1–PEG3–C4–OBn, Boc-C1-PEG3-C4-OBn 95%, 1,1-Dimethylethyl 17-phenyl-3,6,9,16-tetraoxaheptadecanoate, 95%, 95%, Boc-C1-PEG3-C4-OBn, 95.77%, Boc-C1-PEG3-C4-OBn, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 25mg, 50mg, 500 mg, 25 mg.
Tert-butyl 2-[2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethoxy]acetate (CAS 2381196-81-0) is a chemical compound with the molecular formula C23H38O6 and a molecular weight of 410.5 g/mol. IUPAC name: tert-butyl 2-[2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethoxy]acetate. InChIKey: RBTVTEMDPRBJLY-UHFFFAOYSA-N.
| Molecular formula | C23H38O6 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(6-phenylmethoxyhexoxy)ethoxy]ethoxy]acetate |
| InChIKey | RBTVTEMDPRBJLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCCCCCOCC1=CC=CC=C1 |
Computed by PubChem (NCBI)