CAS 2381237-13-2 is the registry number for (4AR,8aR)-6-methyloctahydro-2H-pyrido[4,3-b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,8aR)-6-methyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine (CAS 2381237-13-2) is a chemical compound with the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. IUPAC name: (4aR,8aR)-6-methyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine. InChIKey: YYCQWPUGLXCXGU-HTQZYQBOSA-N.
| Molecular formula | C8H16N2O |
|---|---|
| Molecular weight | 156.23 g/mol |
| IUPAC name | (4aR,8aR)-6-methyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine |
| InChIKey | YYCQWPUGLXCXGU-HTQZYQBOSA-N |
| SMILES | CN1CC[C@@H]2[C@@H](C1)NCCO2 |
Computed by PubChem (NCBI)