CAS 2381462-18-4 is the registry number for (S)-4,5,6,7-Tetrahydro-1H-indazol-7-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7S)-4,5,6,7-tetrahydro-1H-indazol-7-amine (CAS 2381462-18-4) is a chemical compound with the molecular formula C7H11N3 and a molecular weight of 137.18 g/mol. IUPAC name: (7S)-4,5,6,7-tetrahydro-1H-indazol-7-amine. InChIKey: WOALOICTMCSWHN-LURJTMIESA-N.
| Molecular formula | C7H11N3 |
|---|---|
| Molecular weight | 137.18 g/mol |
| IUPAC name | (7S)-4,5,6,7-tetrahydro-1H-indazol-7-amine |
| InChIKey | WOALOICTMCSWHN-LURJTMIESA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=NN2)N |
Computed by PubChem (NCBI)