CAS 2381523-70-0 is the registry number for tert-Butyl (S)-4-(oxazol-2-yl)azepane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S)-4-(1,3-oxazol-2-yl)azepane-1-carboxylate (CAS 2381523-70-0) is a chemical compound with the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. IUPAC name: tert-butyl (4S)-4-(1,3-oxazol-2-yl)azepane-1-carboxylate. InChIKey: IPXLRRUZKXDCAB-NSHDSACASA-N.
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | tert-butyl (4S)-4-(1,3-oxazol-2-yl)azepane-1-carboxylate |
| InChIKey | IPXLRRUZKXDCAB-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CC1)C2=NC=CO2 |
Computed by PubChem (NCBI)