Products 2381879-02-1
CAS 2381879-02-1 is the registry number for ethyl 6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(trifluoromethoxy)pyrrolidine-1,2-dicarboxylate (CAS 2381879-02-1) is a chemical compound with the molecular formula C12H18F3NO5 and a molecular weight of 313.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(trifluoromethoxy)pyrrolidine-1,2-dicarboxylate. InChIKey: GKSJNTKRCSRKIW-SFYZADRCSA-N.
| Molecular formula | C12H18F3NO5 |
|---|---|
| Molecular weight | 313.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(trifluoromethoxy)pyrrolidine-1,2-dicarboxylate |
| InChIKey | GKSJNTKRCSRKIW-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)OC(F)(F)F |
Computed by PubChem (NCBI)