CAS 1398113-31-9 is the registry number for 1-(tert-Butyl) 2-methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate (CAS 1398113-31-9) is a chemical compound with the molecular formula C12H18F3NO5 and a molecular weight of 313.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate. InChIKey: DGNCWUHYOGSFKN-RGENBBCFSA-N.
| Molecular formula | C12H18F3NO5 |
|---|---|
| Molecular weight | 313.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-hydroxy-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| InChIKey | DGNCWUHYOGSFKN-RGENBBCFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)OC)(C(F)(F)F)O |
Computed by PubChem (NCBI)