CAS 23819-87-6 appears in our catalog under these names: 5–Bromo–4,6–dimethyl–2–oxo–1,2–dihydropyridine–3–carbonitrile, 5-Bromo-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile 97%, 5-Bromo-2-hydroxy-4,6-dimethylnicotinonitrile, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
5-bromo-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile (CAS 23819-87-6) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 5-bromo-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: DFGKQCOFARYQOA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 5-bromo-4,6-dimethyl-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | DFGKQCOFARYQOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=C1Br)C)C#N |
Computed by PubChem (NCBI)