CAS 2381972-22-9 is the registry number for (3S)-5-bromo-2,3-dihydrofuro[2,3-b]pyridin-3-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3S)-5-bromo-2,3-dihydrofuro[2,3-b]pyridin-3-amine (CAS 2381972-22-9) is a chemical compound with the molecular formula C7H7BrN2O and a molecular weight of 215.05 g/mol. IUPAC name: (3S)-5-bromo-2,3-dihydrofuro[2,3-b]pyridin-3-amine. InChIKey: CMCBBCIIEZJCNG-ZCFIWIBFSA-N.
| Molecular formula | C7H7BrN2O |
|---|---|
| Molecular weight | 215.05 g/mol |
| IUPAC name | (3S)-5-bromo-2,3-dihydrofuro[2,3-b]pyridin-3-amine |
| InChIKey | CMCBBCIIEZJCNG-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)N=CC(=C2)Br)N |
Computed by PubChem (NCBI)