CAS 2382145-11-9 is the registry number for (R)-5-(Trifluoromethyl)-2-piperidone, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(5R)-5-(trifluoromethyl)piperidin-2-one (CAS 2382145-11-9) is a chemical compound with the molecular formula C6H8F3NO and a molecular weight of 167.13 g/mol. IUPAC name: (5R)-5-(trifluoromethyl)piperidin-2-one. InChIKey: YRKCLUZAQCBIII-SCSAIBSYSA-N.
| Molecular formula | C6H8F3NO |
|---|---|
| Molecular weight | 167.13 g/mol |
| IUPAC name | (5R)-5-(trifluoromethyl)piperidin-2-one |
| InChIKey | YRKCLUZAQCBIII-SCSAIBSYSA-N |
| SMILES | C1CC(=O)NC[C@@H]1C(F)(F)F |
Computed by PubChem (NCBI)