Products 2382303-48-0
CAS 2382303-48-0 is the registry number for tert-Butyl ((3S,4R)-4-(4-aminophenyl)pyrrolidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S,4R)-4-(4-aminophenyl)pyrrolidin-3-yl]carbamate (CAS 2382303-48-0) is a chemical compound with the molecular formula C15H23N3O2 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-(4-aminophenyl)pyrrolidin-3-yl]carbamate. InChIKey: AZMHKBZZNLSUFW-QWHCGFSZSA-N.
| Molecular formula | C15H23N3O2 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-(4-aminophenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | AZMHKBZZNLSUFW-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)