Products 2382679-02-7
CAS 2382679-02-7 is the registry number for Fmoc-RR-Dab(3-Aloc)-OH. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)butanoic acid (CAS 2382679-02-7) is a chemical compound with the molecular formula C23H24N2O6 and a molecular weight of 424.4 g/mol. IUPAC name: (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)butanoic acid. InChIKey: IFXXIYKRKUGABN-JLTOFOAXSA-N.
| Molecular formula | C23H24N2O6 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)butanoic acid |
| InChIKey | IFXXIYKRKUGABN-JLTOFOAXSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)NC(=O)OCC=C |
Computed by PubChem (NCBI)