Products 2382920-52-5
CAS 2382920-52-5 appears in our catalog under these names: Fluralaner Impurity 3, Fluralaner Impurity 7, Fluralaner Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (CAS 2382920-52-5) is a chemical compound with the molecular formula C13H14F3N3O3 and a molecular weight of 317.26 g/mol. IUPAC name: 4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide. InChIKey: NRQWSJIRDVDQHN-PTXOJBNSSA-N.
| Molecular formula | C13H14F3N3O3 |
|---|---|
| Molecular weight | 317.26 g/mol |
| IUPAC name | 4-[(E)-hydroxyiminomethyl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| InChIKey | NRQWSJIRDVDQHN-PTXOJBNSSA-N |
| SMILES | CC1=C(C=CC(=C1)/C=N/O)C(=O)NCC(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)