Products 329064-15-5
CAS 329064-15-5 appears in our catalog under these names: 1-[2-Nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide, 95%, 1-[2-Nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 2g.
1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (CAS 329064-15-5) is a chemical compound with the molecular formula C13H14F3N3O3 and a molecular weight of 317.26 g/mol. IUPAC name: 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide. InChIKey: XDLPTRXKGJMEAX-UHFFFAOYSA-N.
| Molecular formula | C13H14F3N3O3 |
|---|---|
| Molecular weight | 317.26 g/mol |
| IUPAC name | 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| InChIKey | XDLPTRXKGJMEAX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)