Products 2383046-42-0
CAS 2383046-42-0 is the registry number for (E)-N'-(3,4,5-Trimethoxybenzylidene)benzenesulfonohydrazide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzenesulfonamide (CAS 2383046-42-0) is a chemical compound with the molecular formula C16H18N2O5S and a molecular weight of 350.4 g/mol. IUPAC name: N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzenesulfonamide. InChIKey: RBKRKGPHWHICOM-GZTJUZNOSA-N.
| Molecular formula | C16H18N2O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzenesulfonamide |
| InChIKey | RBKRKGPHWHICOM-GZTJUZNOSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=N/NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)