Products 2383244-62-8
CAS 2383244-62-8 is the registry number for tert-Butyl 4-oxo-2-thioxo-2,3,4,5,6,8-hexahydropyrido[3,4-d]pyrimidine-7(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate (CAS 2383244-62-8) is a chemical compound with the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. IUPAC name: tert-butyl 4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate. InChIKey: WLPSXKLBMRLKFB-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | tert-butyl 4-oxo-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate |
| InChIKey | WLPSXKLBMRLKFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)NC(=S)NC2=O |
Computed by PubChem (NCBI)