CAS 199181-39-0 appears in our catalog under these names: 1H-imidazol-1-amine 2,4,6-trimethylbenzene-1-sulfonic acid, 95%, 1H-Imidazol-1-amine, 2,4,6-trimethylbenzene-1-sulfonic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
Imidazol-1-amine;2,4,6-trimethylbenzenesulfonic acid (CAS 199181-39-0) is a chemical compound with the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. IUPAC name: imidazol-1-amine;2,4,6-trimethylbenzenesulfonic acid. InChIKey: BJXQUZUPFYJFPP-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O3S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | imidazol-1-amine;2,4,6-trimethylbenzenesulfonic acid |
| InChIKey | BJXQUZUPFYJFPP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)O)C.C1=CN(C=N1)N |
Computed by PubChem (NCBI)