CAS 2383245-39-2 is the registry number for 1,4-Dichloro-2-iodo-5-(trifluoromethyl)benzene, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1,4-dichloro-2-iodo-5-(trifluoromethyl)benzene (CAS 2383245-39-2) is a chemical compound with the molecular formula C7H2Cl2F3I and a molecular weight of 340.89 g/mol. IUPAC name: 1,4-dichloro-2-iodo-5-(trifluoromethyl)benzene. InChIKey: FVWOMCAHSJTSFT-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3I |
|---|---|
| Molecular weight | 340.89 g/mol |
| IUPAC name | 1,4-dichloro-2-iodo-5-(trifluoromethyl)benzene |
| InChIKey | FVWOMCAHSJTSFT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)I)Cl)C(F)(F)F |
Computed by PubChem (NCBI)