CAS 2383482-17-3 is the registry number for 2-bromo-5-nitro-3-(trifluoromethyl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-bromo-5-nitro-3-(trifluoromethyl)benzaldehyde (CAS 2383482-17-3) is a chemical compound with the molecular formula C8H3BrF3NO3 and a molecular weight of 298.01 g/mol. IUPAC name: 2-bromo-5-nitro-3-(trifluoromethyl)benzaldehyde. InChIKey: HNFQRFBGZJYUEA-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO3 |
|---|---|
| Molecular weight | 298.01 g/mol |
| IUPAC name | 2-bromo-5-nitro-3-(trifluoromethyl)benzaldehyde |
| InChIKey | HNFQRFBGZJYUEA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Br)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)