CAS 2383507-59-1 is the registry number for 4-(((tert-Butyldimethylsilyl)oxy)methyl)-1,2,3-oxathiazolidine 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl-[(2,2-dioxooxathiazolidin-4-yl)methoxy]-dimethylsilane (CAS 2383507-59-1) is a chemical compound with the molecular formula C9H21NO4SSi and a molecular weight of 267.42 g/mol. IUPAC name: tert-butyl-[(2,2-dioxooxathiazolidin-4-yl)methoxy]-dimethylsilane. InChIKey: KMGQJMVZBRHYOH-UHFFFAOYSA-N.
| Molecular formula | C9H21NO4SSi |
|---|---|
| Molecular weight | 267.42 g/mol |
| IUPAC name | tert-butyl-[(2,2-dioxooxathiazolidin-4-yl)methoxy]-dimethylsilane |
| InChIKey | KMGQJMVZBRHYOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1COS(=O)(=O)N1 |
Computed by PubChem (NCBI)