CAS 2383807-57-4 appears in our catalog under these names: 4-Amino-3-bromo-5-chlorophenyl-2-bromoethanone, Clenbuterol Impurity 1. Offered by: TRC, Chemat Brand. Available pack sizes: 750mg, on request.
1-(4-amino-3-bromo-5-chlorophenyl)-2-bromoethanone (CAS 2383807-57-4) is a chemical compound with the molecular formula C8H6Br2ClNO and a molecular weight of 327.40 g/mol. IUPAC name: 1-(4-amino-3-bromo-5-chlorophenyl)-2-bromoethanone. InChIKey: JRLVTGRWQCKOSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2ClNO |
|---|---|
| Molecular weight | 327.40 g/mol |
| IUPAC name | 1-(4-amino-3-bromo-5-chlorophenyl)-2-bromoethanone |
| InChIKey | JRLVTGRWQCKOSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Br)C(=O)CBr |
Computed by PubChem (NCBI)