CAS 2383921-02-4 is the registry number for 4-Chloro-7-iodo-3-nitroquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-7-iodo-3-nitroquinoline (CAS 2383921-02-4) is a chemical compound with the molecular formula C9H4ClIN2O2 and a molecular weight of 334.50 g/mol. IUPAC name: 4-chloro-7-iodo-3-nitroquinoline. InChIKey: UUWKNEPAGXBUGS-UHFFFAOYSA-N.
| Molecular formula | C9H4ClIN2O2 |
|---|---|
| Molecular weight | 334.50 g/mol |
| IUPAC name | 4-chloro-7-iodo-3-nitroquinoline |
| InChIKey | UUWKNEPAGXBUGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1I)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)