CAS 2384416-38-8 appears in our catalog under these names: 3-(Dibromomethyl)-7-fluoro-2H-chromen-2-one, 98%, 3-(Dibromomethyl)-7-fluoro-2H-chromen-2-one, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 25mg, 250mg, 1g, 100mg.
3-(dibromomethyl)-7-fluorochromen-2-one (CAS 2384416-38-8) is a chemical compound with the molecular formula C10H5Br2FO2 and a molecular weight of 335.95 g/mol. IUPAC name: 3-(dibromomethyl)-7-fluorochromen-2-one. InChIKey: PUPXNPILMGQNJZ-UHFFFAOYSA-N.
| Molecular formula | C10H5Br2FO2 |
|---|---|
| Molecular weight | 335.95 g/mol |
| IUPAC name | 3-(dibromomethyl)-7-fluorochromen-2-one |
| InChIKey | PUPXNPILMGQNJZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC(=O)C(=C2)C(Br)Br |
Computed by PubChem (NCBI)