Products 2384724-24-5
CAS 2384724-24-5 appears in our catalog under these names: 2-(2-Amino-4-bromo-3-fluorophenyl)-2-oxoacetic acid, 98%, 98%, 2-(2-Amino-4-bromo-3-fluorophenyl)-2-oxoacetic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(2-amino-4-bromo-3-fluorophenyl)-2-oxoacetic acid (CAS 2384724-24-5) is a chemical compound with the molecular formula C8H5BrFNO3 and a molecular weight of 262.03 g/mol. IUPAC name: 2-(2-amino-4-bromo-3-fluorophenyl)-2-oxoacetic acid. InChIKey: YMAUWUUBQZRFAS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO3 |
|---|---|
| Molecular weight | 262.03 g/mol |
| IUPAC name | 2-(2-amino-4-bromo-3-fluorophenyl)-2-oxoacetic acid |
| InChIKey | YMAUWUUBQZRFAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)C(=O)O)N)F)Br |
Computed by PubChem (NCBI)