Products 2384727-54-0

CAS 2384727-54-0 is the registry number for 2-Fluorocyclopent-1-ene-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-fluorocyclopentene-1-carboxylic acid (CAS 2384727-54-0) is a chemical compound with the molecular formula C6H7FO2 and a molecular weight of 130.12 g/mol. IUPAC name: 2-fluorocyclopentene-1-carboxylic acid. InChIKey: SOFWSYKYMCTCCG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7FO2
Molecular weight130.12 g/mol
IUPAC name2-fluorocyclopentene-1-carboxylic acid
InChIKeySOFWSYKYMCTCCG-UHFFFAOYSA-N
SMILESC1CC(=C(C1)F)C(=O)O

Computed by PubChem (NCBI)