Products 2384870-52-2
CAS 2384870-52-2 is the registry number for Methyl 3-Bromo-1-Boc-azetidine-3-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate (CAS 2384870-52-2) is a chemical compound with the molecular formula C10H16BrNO4 and a molecular weight of 294.14 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate. InChIKey: GLWKSLRSSYNYCY-UHFFFAOYSA-N.
| Molecular formula | C10H16BrNO4 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-bromoazetidine-1,3-dicarboxylate |
| InChIKey | GLWKSLRSSYNYCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)OC)Br |
Computed by PubChem (NCBI)