CAS 475288-42-7 is the registry number for (E)-3-Bromo-2-tert-butoxycarbonylamino-but-2-enoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl (E)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate (CAS 475288-42-7) is a chemical compound with the molecular formula C10H16BrNO4 and a molecular weight of 294.14 g/mol. IUPAC name: methyl (E)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate. InChIKey: BMYTUCFBIJPZLT-VOTSOKGWSA-N.
| Molecular formula | C10H16BrNO4 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | methyl (E)-3-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
| InChIKey | BMYTUCFBIJPZLT-VOTSOKGWSA-N |
| SMILES | C/C(=C(/C(=O)OC)\NC(=O)OC(C)(C)C)/Br |
Computed by PubChem (NCBI)