Products 2384872-75-5
CAS 2384872-75-5 is the registry number for 1-Bromo-4-iodo-5-methoxy-2-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1-bromo-4-iodo-5-methoxy-2-(trifluoromethyl)benzene (CAS 2384872-75-5) is a chemical compound with the molecular formula C8H5BrF3IO and a molecular weight of 380.93 g/mol. IUPAC name: 1-bromo-4-iodo-5-methoxy-2-(trifluoromethyl)benzene. InChIKey: QWERVBCTSVALJG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3IO |
|---|---|
| Molecular weight | 380.93 g/mol |
| IUPAC name | 1-bromo-4-iodo-5-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | QWERVBCTSVALJG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Br)C(F)(F)F)I |
Computed by PubChem (NCBI)