Products 2384926-09-2
CAS 2384926-09-2 is the registry number for 2-Ethoxy-1-iodo-4-(trifluoromethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-ethoxy-1-iodo-4-(trifluoromethyl)benzene (CAS 2384926-09-2) is a chemical compound with the molecular formula C9H8F3IO and a molecular weight of 316.06 g/mol. IUPAC name: 2-ethoxy-1-iodo-4-(trifluoromethyl)benzene. InChIKey: VJJYVQJGOGXEOJ-UHFFFAOYSA-N.
| Molecular formula | C9H8F3IO |
|---|---|
| Molecular weight | 316.06 g/mol |
| IUPAC name | 2-ethoxy-1-iodo-4-(trifluoromethyl)benzene |
| InChIKey | VJJYVQJGOGXEOJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(F)(F)F)I |
Computed by PubChem (NCBI)