Products 2385165-72-8
CAS 2385165-72-8 is the registry number for 1-(3-Bromo-4-fluoro-5-iodophenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-bromo-4-fluoro-5-iodophenyl)ethanone (CAS 2385165-72-8) is a chemical compound with the molecular formula C8H5BrFIO and a molecular weight of 342.93 g/mol. IUPAC name: 1-(3-bromo-4-fluoro-5-iodophenyl)ethanone. InChIKey: WCWXZXCWDIQLSL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFIO |
|---|---|
| Molecular weight | 342.93 g/mol |
| IUPAC name | 1-(3-bromo-4-fluoro-5-iodophenyl)ethanone |
| InChIKey | WCWXZXCWDIQLSL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)I)F)Br |
Computed by PubChem (NCBI)