Products 2385179-99-5
CAS 2385179-99-5 is the registry number for 3-Bromo-6-chloro-2,5-difluorobenzonitrile, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-chloro-3,6-difluorobenzonitrile (CAS 2385179-99-5) is a chemical compound with the molecular formula C7HBrClF2N and a molecular weight of 252.44 g/mol. IUPAC name: 5-bromo-2-chloro-3,6-difluorobenzonitrile. InChIKey: AGCXOMWVAOPVLN-UHFFFAOYSA-N.
| Molecular formula | C7HBrClF2N |
|---|---|
| Molecular weight | 252.44 g/mol |
| IUPAC name | 5-bromo-2-chloro-3,6-difluorobenzonitrile |
| InChIKey | AGCXOMWVAOPVLN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C#N)Cl)F |
Computed by PubChem (NCBI)