CAS 2385185-75-9 is the registry number for 2-Cyano-N-((furan-2-ylmethyl)carbamoyl)acetamide. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
(3R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;propan-2-ol (CAS 2385185-75-9) is a chemical compound with the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. IUPAC name: (3R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;propan-2-ol. InChIKey: WVMPTGPZDFFKLG-CQAWBSMRSA-N.
| Molecular formula | C10H22O7 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (3R,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol;propan-2-ol |
| InChIKey | WVMPTGPZDFFKLG-CQAWBSMRSA-N |
| SMILES | CC(C)O.CO[C@H]1C(C([C@H](C(O1)CO)O)O)O |
Computed by PubChem (NCBI)