CAS 2385244-13-1 is the registry number for 1-Fluoro-5-iodo-3-methoxy-2-nitrobenzene, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-fluoro-5-iodo-3-methoxy-2-nitrobenzene (CAS 2385244-13-1) is a chemical compound with the molecular formula C7H5FINO3 and a molecular weight of 297.02 g/mol. IUPAC name: 1-fluoro-5-iodo-3-methoxy-2-nitrobenzene. InChIKey: UYSOWUDZTYYYFY-UHFFFAOYSA-N.
| Molecular formula | C7H5FINO3 |
|---|---|
| Molecular weight | 297.02 g/mol |
| IUPAC name | 1-fluoro-5-iodo-3-methoxy-2-nitrobenzene |
| InChIKey | UYSOWUDZTYYYFY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)I)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)