Products 2385491-46-1
CAS 2385491-46-1 is the registry number for Methyl 2-bromo-4-iodo-6-methylbenzeneacetate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(2-bromo-4-iodo-6-methylphenyl)acetate (CAS 2385491-46-1) is a chemical compound with the molecular formula C10H10BrIO2 and a molecular weight of 368.99 g/mol. IUPAC name: methyl 2-(2-bromo-4-iodo-6-methylphenyl)acetate. InChIKey: MVSAKPFNDVTBFZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrIO2 |
|---|---|
| Molecular weight | 368.99 g/mol |
| IUPAC name | methyl 2-(2-bromo-4-iodo-6-methylphenyl)acetate |
| InChIKey | MVSAKPFNDVTBFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC(=O)OC)Br)I |
Computed by PubChem (NCBI)