Products 1261585-99-2
CAS 1261585-99-2 is the registry number for Ethyl 2-(4-Bromo-2-iodophenyl)acetate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-(4-bromo-2-iodophenyl)acetate (CAS 1261585-99-2) is a chemical compound with the molecular formula C10H10BrIO2 and a molecular weight of 368.99 g/mol. IUPAC name: ethyl 2-(4-bromo-2-iodophenyl)acetate. InChIKey: CTOQPHUHMKAWNR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrIO2 |
|---|---|
| Molecular weight | 368.99 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-iodophenyl)acetate |
| InChIKey | CTOQPHUHMKAWNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Br)I |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2-(4-bromo-2-iodophenyl)acetate