Products 2385537-79-9

CAS 2385537-79-9 is the registry number for 1-Chloro-4-iodo-2,3-dimethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-chloro-4-iodo-2,3-dimethylbenzene (CAS 2385537-79-9) is a chemical compound with the molecular formula C8H8ClI and a molecular weight of 266.50 g/mol. IUPAC name: 1-chloro-4-iodo-2,3-dimethylbenzene. InChIKey: HYFKIKWNWWBDHD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClI
Molecular weight266.50 g/mol
IUPAC name1-chloro-4-iodo-2,3-dimethylbenzene
InChIKeyHYFKIKWNWWBDHD-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1C)I)Cl

Computed by PubChem (NCBI)