CAS 2385677-79-0 is the registry number for 3-((4-chloropyridin-2-yl)oxy)-6-iodo-2-methylpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-[(4-chloro-2-pyridinyl)oxy]-6-iodo-2-methylpyridine (CAS 2385677-79-0) is a chemical compound with the molecular formula C11H8ClIN2O and a molecular weight of 346.55 g/mol. IUPAC name: 3-[(4-chloro-2-pyridinyl)oxy]-6-iodo-2-methylpyridine. InChIKey: MWDSQVLFJQRWGI-UHFFFAOYSA-N.
| Molecular formula | C11H8ClIN2O |
|---|---|
| Molecular weight | 346.55 g/mol |
| IUPAC name | 3-[(4-chloro-2-pyridinyl)oxy]-6-iodo-2-methylpyridine |
| InChIKey | MWDSQVLFJQRWGI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)I)OC2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)