CAS 2385779-68-8 is the registry number for 1,5-Dibromo-3-chloro-2-(difluoromethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
1,5-dibromo-3-chloro-2-(difluoromethoxy)benzene (CAS 2385779-68-8) is a chemical compound with the molecular formula C7H3Br2ClF2O and a molecular weight of 336.35 g/mol. IUPAC name: 1,5-dibromo-3-chloro-2-(difluoromethoxy)benzene. InChIKey: WXWUDAYYDNTHBG-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClF2O |
|---|---|
| Molecular weight | 336.35 g/mol |
| IUPAC name | 1,5-dibromo-3-chloro-2-(difluoromethoxy)benzene |
| InChIKey | WXWUDAYYDNTHBG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OC(F)F)Br)Br |
Computed by PubChem (NCBI)